C19H23N5O3 — CID 91361805
N-cyclopentyl-9-(6-ethynyl-2,2-dimethyl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-3a-yl)purin-6-amine (PubChem CID 91361805) has the molecular formula C19H23N5O3 and a molecular weight of 369.43 g/mol. Its IUPAC name is N-cyclopentyl-9-(6-ethynyl-2,2-dimethyl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-3a-yl)purin-6-amine.
| Compound Name | N-cyclopentyl-9-(6-ethynyl-2,2-dimethyl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-3a-yl)purin-6-amine |
|---|---|
| PubChem CID | 91361805 |
| Molecular Formula | C19H23N5O3 |
| Molecular Weight | 369.43 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | N-cyclopentyl-9-(6-ethynyl-2,2-dimethyl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-3a-yl)purin-6-amine |
| SMILES | C#CC1OCC2(n3cnc4c(NC5CCCC5)ncnc43)OC(C)(C)OC12 |
| InChI | InChI=1S/C19H23N5O3/c1-4-13-15-19(9-25-13,27-18(2,3)26-15)24-11-22-14-16(20-10-21-17(14)24)23-12-7-5-6-8-12/h1,10-13,15H,5-9H2,2-3H3,(H,20,21,23) |
| InChIKey | YUTXSQAXYHWAOQ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 83.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.43 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|