C24H27N7O5 — CID 163740029
2-[3-[[(3aS,6R,6aR)-3a-(6-aminopurin-9-yl)-2,2-dimethyl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-6-yl]methylamino]propyl]isoindole-1,3-dione (PubChem CID 163740029) has the molecular formula C24H27N7O5 and a molecular weight of 493.52 g/mol. Its IUPAC name is 2-[3-[[(3aS,6R,6aR)-3a-(6-aminopurin-9-yl)-2,2-dimethyl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-6-yl]methylamino]propyl]isoindole-1,3-dione.
| Compound Name | 2-[3-[[(3aS,6R,6aR)-3a-(6-aminopurin-9-yl)-2,2-dimethyl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-6-yl]methylamino]propyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 163740029 |
| Molecular Formula | C24H27N7O5 |
| Molecular Weight | 493.52 g/mol |
| Exact Mass | 493.21 |
| IUPAC Name | 2-[3-[[(3aS,6R,6aR)-3a-(6-aminopurin-9-yl)-2,2-dimethyl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-6-yl]methylamino]propyl]isoindole-1,3-dione |
| SMILES | CC1(C)O[C@@H]2[C@@H](CNCCCN3C(=O)c4ccccc4C3=O)OC[C@]2(n2cnc3c(N)ncnc32)O1 |
| InChI | InChI=1S/C24H27N7O5/c1-23(2)35-18-16(10-26-8-5-9-30-21(32)14-6-3-4-7-15(14)22(30)33)34-11-24(18,36-23)31-13-29-17-19(25)27-12-28-20(17)31/h3-4,6-7,12-13,16,18,26H,5,8-11H2,1-2H3,(H2,25,27,28)/t16-,18-,24+/m1/s1 |
| InChIKey | LGYLEMGWWAIGDJ-OSWMTFESSA-N |
| XLogP | 0.89 |
| TPSA | 146.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.52 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|