C18H21N9O3 — CID 139448182
4-(6-aminopurin-9-yl)-2-[[2-(benzotriazol-1-yl)ethylamino]methyl]oxolane-3,4-diol (PubChem CID 139448182) has the molecular formula C18H21N9O3 and a molecular weight of 411.43 g/mol. Its IUPAC name is 4-(6-aminopurin-9-yl)-2-[[2-(benzotriazol-1-yl)ethylamino]methyl]oxolane-3,4-diol.
| Compound Name | 4-(6-aminopurin-9-yl)-2-[[2-(benzotriazol-1-yl)ethylamino]methyl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 139448182 |
| Molecular Formula | C18H21N9O3 |
| Molecular Weight | 411.43 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | 4-(6-aminopurin-9-yl)-2-[[2-(benzotriazol-1-yl)ethylamino]methyl]oxolane-3,4-diol |
| SMILES | Nc1ncnc2c1ncn2C1(O)COC(CNCCn2nnc3ccccc32)C1O |
| InChI | InChI=1S/C18H21N9O3/c19-16-14-17(22-9-21-16)26(10-23-14)18(29)8-30-13(15(18)28)7-20-5-6-27-12-4-2-1-3-11(12)24-25-27/h1-4,9-10,13,15,20,28-29H,5-8H2,(H2,19,21,22) |
| InChIKey | QLZJOFCFLHJXIF-UHFFFAOYSA-N |
| XLogP | -1.15 |
| TPSA | 162.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.43 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|