C28H42N8O4 — CID 123246922
1-[3-[[4-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl-(2-methylpropyl)amino]propyl]-3-(4-tert-butylphenyl)urea (PubChem CID 123246922) has the molecular formula C28H42N8O4 and a molecular weight of 554.70 g/mol. Its IUPAC name is 1-[3-[[4-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl-(2-methylpropyl)amino]propyl]-3-(4-tert-butylphenyl)urea.
| Compound Name | 1-[3-[[4-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl-(2-methylpropyl)amino]propyl]-3-(4-tert-butylphenyl)urea |
|---|---|
| PubChem CID | 123246922 |
| Molecular Formula | C28H42N8O4 |
| Molecular Weight | 554.70 g/mol |
| Exact Mass | 554.33 |
| IUPAC Name | 1-[3-[[4-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl-(2-methylpropyl)amino]propyl]-3-(4-tert-butylphenyl)urea |
| SMILES | CC(C)CN(CCCNC(=O)Nc1ccc(C(C)(C)C)cc1)CC1OCC(O)(n2cnc3c(N)ncnc32)C1O |
| InChI | InChI=1S/C28H42N8O4/c1-18(2)13-35(12-6-11-30-26(38)34-20-9-7-19(8-10-20)27(3,4)5)14-21-23(37)28(39,15-40-21)36-17-33-22-24(29)31-16-32-25(22)36/h7-10,16-18,21,23,37,39H,6,11-15H2,1-5H3,(H2,29,31,32)(H2,30,34,38) |
| InChIKey | PZZBJCKFDOSTOY-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 163.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.70 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|