C24H30Cl2N8O4 — CID 123248652
1-[3-[[3a-(6-aminopurin-9-yl)-2,2-dimethyl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-6-yl]methyl-methylamino]propyl]-3-(3,4-dichlorophenyl)urea (PubChem CID 123248652) has the molecular formula C24H30Cl2N8O4 and a molecular weight of 565.46 g/mol. Its IUPAC name is 1-[3-[[3a-(6-aminopurin-9-yl)-2,2-dimethyl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-6-yl]methyl-methylamino]propyl]-3-(3,4-dichlorophenyl)urea.
| Compound Name | 1-[3-[[3a-(6-aminopurin-9-yl)-2,2-dimethyl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-6-yl]methyl-methylamino]propyl]-3-(3,4-dichlorophenyl)urea |
|---|---|
| PubChem CID | 123248652 |
| Molecular Formula | C24H30Cl2N8O4 |
| Molecular Weight | 565.46 g/mol |
| Exact Mass | 564.18 |
| IUPAC Name | 1-[3-[[3a-(6-aminopurin-9-yl)-2,2-dimethyl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-6-yl]methyl-methylamino]propyl]-3-(3,4-dichlorophenyl)urea |
| SMILES | CN(CCCNC(=O)Nc1ccc(Cl)c(Cl)c1)CC1OCC2(n3cnc4c(N)ncnc43)OC(C)(C)OC12 |
| InChI | InChI=1S/C24H30Cl2N8O4/c1-23(2)37-19-17(36-11-24(19,38-23)34-13-31-18-20(27)29-12-30-21(18)34)10-33(3)8-4-7-28-22(35)32-14-5-6-15(25)16(26)9-14/h5-6,9,12-13,17,19H,4,7-8,10-11H2,1-3H3,(H2,27,29,30)(H2,28,32,35) |
| InChIKey | CTHBARPQZOGMLU-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 141.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.46 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|