C27H40N8O3 — CID 123354607
1-[3-[[4-(6-aminopurin-9-yl)-4-hydroxyoxolan-2-yl]methyl-propan-2-ylamino]propyl]-3-(4-tert-butylphenyl)urea (PubChem CID 123354607) has the molecular formula C27H40N8O3 and a molecular weight of 524.67 g/mol. Its IUPAC name is 1-[3-[[4-(6-aminopurin-9-yl)-4-hydroxyoxolan-2-yl]methyl-propan-2-ylamino]propyl]-3-(4-tert-butylphenyl)urea.
| Compound Name | 1-[3-[[4-(6-aminopurin-9-yl)-4-hydroxyoxolan-2-yl]methyl-propan-2-ylamino]propyl]-3-(4-tert-butylphenyl)urea |
|---|---|
| PubChem CID | 123354607 |
| Molecular Formula | C27H40N8O3 |
| Molecular Weight | 524.67 g/mol |
| Exact Mass | 524.32 |
| IUPAC Name | 1-[3-[[4-(6-aminopurin-9-yl)-4-hydroxyoxolan-2-yl]methyl-propan-2-ylamino]propyl]-3-(4-tert-butylphenyl)urea |
| SMILES | CC(C)N(CCCNC(=O)Nc1ccc(C(C)(C)C)cc1)CC1CC(O)(n2cnc3c(N)ncnc32)CO1 |
| InChI | InChI=1S/C27H40N8O3/c1-18(2)34(12-6-11-29-25(36)33-20-9-7-19(8-10-20)26(3,4)5)14-21-13-27(37,15-38-21)35-17-32-22-23(28)30-16-31-24(22)35/h7-10,16-18,21,37H,6,11-15H2,1-5H3,(H2,28,30,31)(H2,29,33,36) |
| InChIKey | LVLXXCWALSDBCV-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 143.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.67 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|