C25H35N7O4S — CID 123946470
1-[3-[[4-(6-aminopurin-9-yl)-4-methyloxolan-2-yl]methylsulfonyl]propyl]-3-(4-tert-butylphenyl)urea (PubChem CID 123946470) has the molecular formula C25H35N7O4S and a molecular weight of 529.67 g/mol. Its IUPAC name is 1-[3-[[4-(6-aminopurin-9-yl)-4-methyloxolan-2-yl]methylsulfonyl]propyl]-3-(4-tert-butylphenyl)urea.
| Compound Name | 1-[3-[[4-(6-aminopurin-9-yl)-4-methyloxolan-2-yl]methylsulfonyl]propyl]-3-(4-tert-butylphenyl)urea |
|---|---|
| PubChem CID | 123946470 |
| Molecular Formula | C25H35N7O4S |
| Molecular Weight | 529.67 g/mol |
| Exact Mass | 529.25 |
| IUPAC Name | 1-[3-[[4-(6-aminopurin-9-yl)-4-methyloxolan-2-yl]methylsulfonyl]propyl]-3-(4-tert-butylphenyl)urea |
| SMILES | CC(C)(C)c1ccc(NC(=O)NCCCS(=O)(=O)CC2CC(C)(n3cnc4c(N)ncnc43)CO2)cc1 |
| InChI | InChI=1S/C25H35N7O4S/c1-24(2,3)17-6-8-18(9-7-17)31-23(33)27-10-5-11-37(34,35)13-19-12-25(4,14-36-19)32-16-30-20-21(26)28-15-29-22(20)32/h6-9,15-16,19H,5,10-14H2,1-4H3,(H2,26,28,29)(H2,27,31,33) |
| InChIKey | ZBNWUWUETPVHDX-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 154.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.67 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|