C30H44N8O4 — CID 123897662
1-[3-[[3a-(6-aminopurin-9-yl)-2,2-dimethyl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-6-yl]methyl-methylamino]-2,2-dimethylpropyl]-3-(4-tert-butylphenyl)urea (PubChem CID 123897662) has the molecular formula C30H44N8O4 and a molecular weight of 580.73 g/mol. Its IUPAC name is 1-[3-[[3a-(6-aminopurin-9-yl)-2,2-dimethyl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-6-yl]methyl-methylamino]-2,2-dimethylpropyl]-3-(4-tert-butylphenyl)urea.
| Compound Name | 1-[3-[[3a-(6-aminopurin-9-yl)-2,2-dimethyl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-6-yl]methyl-methylamino]-2,2-dimethylpropyl]-3-(4-tert-butylphenyl)urea |
|---|---|
| PubChem CID | 123897662 |
| Molecular Formula | C30H44N8O4 |
| Molecular Weight | 580.73 g/mol |
| Exact Mass | 580.35 |
| IUPAC Name | 1-[3-[[3a-(6-aminopurin-9-yl)-2,2-dimethyl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-6-yl]methyl-methylamino]-2,2-dimethylpropyl]-3-(4-tert-butylphenyl)urea |
| SMILES | CN(CC1OCC2(n3cnc4c(N)ncnc43)OC(C)(C)OC12)CC(C)(C)CNC(=O)Nc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C30H44N8O4/c1-27(2,3)19-9-11-20(12-10-19)36-26(39)32-14-28(4,5)15-37(8)13-21-23-30(16-40-21,42-29(6,7)41-23)38-18-35-22-24(31)33-17-34-25(22)38/h9-12,17-18,21,23H,13-16H2,1-8H3,(H2,31,33,34)(H2,32,36,39) |
| InChIKey | AQUHJQSGSTXMPL-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 141.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.73 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |