C17H16FN5O5S — CID 87855304
[(2R,3S,4R,5R)-2-(6-aminopurin-9-yl)-2-benzoyl-3,4-dihydroxy-5-(hydroxymethyl)oxolan-3-yl] thiohypofluorite (PubChem CID 87855304) has the molecular formula C17H16FN5O5S and a molecular weight of 421.41 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-2-(6-aminopurin-9-yl)-2-benzoyl-3,4-dihydroxy-5-(hydroxymethyl)oxolan-3-yl] thiohypofluorite.
| Compound Name | [(2R,3S,4R,5R)-2-(6-aminopurin-9-yl)-2-benzoyl-3,4-dihydroxy-5-(hydroxymethyl)oxolan-3-yl] thiohypofluorite |
|---|---|
| PubChem CID | 87855304 |
| Molecular Formula | C17H16FN5O5S |
| Molecular Weight | 421.41 g/mol |
| Exact Mass | 421.09 |
| IUPAC Name | [(2R,3S,4R,5R)-2-(6-aminopurin-9-yl)-2-benzoyl-3,4-dihydroxy-5-(hydroxymethyl)oxolan-3-yl] thiohypofluorite |
| SMILES | Nc1ncnc2c1ncn2[C@]1(C(=O)c2ccccc2)O[C@H](CO)[C@@H](O)[C@]1(O)SF |
| InChI | InChI=1S/C17H16FN5O5S/c18-29-17(27)13(26)10(6-24)28-16(17,12(25)9-4-2-1-3-5-9)23-8-22-11-14(19)20-7-21-15(11)23/h1-5,7-8,10,13,24,26-27H,6H2,(H2,19,20,21)/t10-,13-,16-,17+/m1/s1 |
| InChIKey | CHBRBHRBBOTSMP-IXZQUYOESA-N |
| XLogP | 0.00 |
| TPSA | 156.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.41 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|