C18H21N5O4 — CID 67643724
(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-5-benzyl-2-(hydroxymethyl)-4-methoxyoxolan-3-ol (PubChem CID 67643724) has the molecular formula C18H21N5O4 and a molecular weight of 371.40 g/mol. Its IUPAC name is (2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-5-benzyl-2-(hydroxymethyl)-4-methoxyoxolan-3-ol.
| Compound Name | (2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-5-benzyl-2-(hydroxymethyl)-4-methoxyoxolan-3-ol |
|---|---|
| PubChem CID | 67643724 |
| Molecular Formula | C18H21N5O4 |
| Molecular Weight | 371.40 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | (2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-5-benzyl-2-(hydroxymethyl)-4-methoxyoxolan-3-ol |
| SMILES | CO[C@@H]1[C@H](O)[C@@H](CO)O[C@@]1(Cc1ccccc1)n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C18H21N5O4/c1-26-15-14(25)12(8-24)27-18(15,7-11-5-3-2-4-6-11)23-10-22-13-16(19)20-9-21-17(13)23/h2-6,9-10,12,14-15,24-25H,7-8H2,1H3,(H2,19,20,21)/t12-,14-,15-,18-/m1/s1 |
| InChIKey | RBWSOFPOZFHVCB-SCFUHWHPSA-N |
| XLogP | 0.07 |
| TPSA | 128.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.40 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |