C17H19N5O5 — CID 141398371
(2R,3R,4S,5R)-2-benzyl-2-[6-(hydroxyamino)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 141398371) has the molecular formula C17H19N5O5 and a molecular weight of 373.37 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-benzyl-2-[6-(hydroxyamino)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-benzyl-2-[6-(hydroxyamino)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 141398371 |
| Molecular Formula | C17H19N5O5 |
| Molecular Weight | 373.37 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | (2R,3R,4S,5R)-2-benzyl-2-[6-(hydroxyamino)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | OC[C@H]1O[C@@](Cc2ccccc2)(n2cnc3c(NO)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C17H19N5O5/c23-7-11-13(24)14(25)17(27-11,6-10-4-2-1-3-5-10)22-9-20-12-15(21-26)18-8-19-16(12)22/h1-5,8-9,11,13-14,23-26H,6-7H2,(H,18,19,21)/t11-,13-,14-,17-/m1/s1 |
| InChIKey | XZLIMRPGBHFRLC-LSCFUAHRSA-N |
| XLogP | -0.36 |
| TPSA | 145.78 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.37 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|