C17H19N5O5 — CID 70179917
(2R,3R,4S,5R)-2-benzyl-2-(1-hydroxy-6-iminopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 70179917) has the molecular formula C17H19N5O5 and a molecular weight of 373.37 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-benzyl-2-(1-hydroxy-6-iminopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-benzyl-2-(1-hydroxy-6-iminopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 70179917 |
| Molecular Formula | C17H19N5O5 |
| Molecular Weight | 373.37 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | (2R,3R,4S,5R)-2-benzyl-2-(1-hydroxy-6-iminopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | [H]/N=c1/c2ncn([C@]3(Cc4ccccc4)O[C@H](CO)[C@@H](O)[C@H]3O)c2ncn1O |
| InChI | InChI=1S/C17H19N5O5/c18-15-12-16(20-9-22(15)26)21(8-19-12)17(6-10-4-2-1-3-5-10)14(25)13(24)11(7-23)27-17/h1-5,8-9,11,13-14,18,23-26H,6-7H2/b18-15-/t11-,13-,14-,17-/m1/s1 |
| InChIKey | COGUSRRFPGVHQD-ASIMTJLASA-N |
| XLogP | -1.04 |
| TPSA | 149.64 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.37 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|