C13H15F3N6O4 — CID 145099504
N-[(2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-4-hydroxy-5-(hydroxymethyl)-2-methyloxolan-3-yl]-2,2,2-trifluoroacetamide (PubChem CID 145099504) has the molecular formula C13H15F3N6O4 and a molecular weight of 376.30 g/mol. Its IUPAC name is N-[(2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-4-hydroxy-5-(hydroxymethyl)-2-methyloxolan-3-yl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[(2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-4-hydroxy-5-(hydroxymethyl)-2-methyloxolan-3-yl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 145099504 |
| Molecular Formula | C13H15F3N6O4 |
| Molecular Weight | 376.30 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | N-[(2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-4-hydroxy-5-(hydroxymethyl)-2-methyloxolan-3-yl]-2,2,2-trifluoroacetamide |
| SMILES | C[C@@]1(n2cnc3c(N)ncnc32)O[C@H](CO)[C@@H](O)[C@H]1NC(=O)C(F)(F)F |
| InChI | InChI=1S/C13H15F3N6O4/c1-12(22-4-20-6-9(17)18-3-19-10(6)22)8(7(24)5(2-23)26-12)21-11(25)13(14,15)16/h3-5,7-8,23-24H,2H2,1H3,(H,21,25)(H2,17,18,19)/t5-,7-,8-,12-/m1/s1 |
| InChIKey | JDBKOYPZMQKUEP-JTFADIMSSA-N |
| XLogP | -1.12 |
| TPSA | 148.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.30 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |