C11H13F2N5O3S — CID 87534735
(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-5-(difluoromethyl)-2-(hydroxymethyl)-4-sulfanyloxolan-3-ol (PubChem CID 87534735) has the molecular formula C11H13F2N5O3S and a molecular weight of 333.32 g/mol. Its IUPAC name is (2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-5-(difluoromethyl)-2-(hydroxymethyl)-4-sulfanyloxolan-3-ol.
| Compound Name | (2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-5-(difluoromethyl)-2-(hydroxymethyl)-4-sulfanyloxolan-3-ol |
|---|---|
| PubChem CID | 87534735 |
| Molecular Formula | C11H13F2N5O3S |
| Molecular Weight | 333.32 g/mol |
| Exact Mass | 333.07 |
| IUPAC Name | (2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-5-(difluoromethyl)-2-(hydroxymethyl)-4-sulfanyloxolan-3-ol |
| SMILES | Nc1ncnc2c1ncn2[C@]1(C(F)F)O[C@H](CO)[C@@H](O)[C@H]1S |
| InChI | InChI=1S/C11H13F2N5O3S/c12-10(13)11(7(22)6(20)4(1-19)21-11)18-3-17-5-8(14)15-2-16-9(5)18/h2-4,6-7,10,19-20,22H,1H2,(H2,14,15,16)/t4-,6-,7-,11+/m1/s1 |
| InChIKey | IPYDVOKUBPKTPO-HEIFUQTGSA-N |
| XLogP | -0.62 |
| TPSA | 119.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.32 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|