C16H27N5O4Si — CID 67570457
(2S,3R,4S,5R)-2-(6-aminopurin-9-yl)-2-[tert-butyl(dimethyl)silyl]-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 67570457) has the molecular formula C16H27N5O4Si and a molecular weight of 381.51 g/mol. Its IUPAC name is (2S,3R,4S,5R)-2-(6-aminopurin-9-yl)-2-[tert-butyl(dimethyl)silyl]-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2S,3R,4S,5R)-2-(6-aminopurin-9-yl)-2-[tert-butyl(dimethyl)silyl]-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 67570457 |
| Molecular Formula | C16H27N5O4Si |
| Molecular Weight | 381.51 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | (2S,3R,4S,5R)-2-(6-aminopurin-9-yl)-2-[tert-butyl(dimethyl)silyl]-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | CC(C)(C)[Si](C)(C)[C@@]1(n2cnc3c(N)ncnc32)O[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C16H27N5O4Si/c1-15(2,3)26(4,5)16(12(24)11(23)9(6-22)25-16)21-8-20-10-13(17)18-7-19-14(10)21/h7-9,11-12,22-24H,6H2,1-5H3,(H2,17,18,19)/t9-,11-,12-,16+/m1/s1 |
| InChIKey | YQYHADOJHFFUCK-JRFJBVBDSA-N |
| XLogP | 0.22 |
| TPSA | 139.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.51 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|