C18H27N5O4Si — CID 70147031
(2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-(hydroxymethyl)-2-(2-triethylsilylethynyl)oxolane-3,4-diol (PubChem CID 70147031) has the molecular formula C18H27N5O4Si and a molecular weight of 405.53 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-(hydroxymethyl)-2-(2-triethylsilylethynyl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-(hydroxymethyl)-2-(2-triethylsilylethynyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 70147031 |
| Molecular Formula | C18H27N5O4Si |
| Molecular Weight | 405.53 g/mol |
| Exact Mass | 405.18 |
| IUPAC Name | (2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-(hydroxymethyl)-2-(2-triethylsilylethynyl)oxolane-3,4-diol |
| SMILES | CC[Si](C#C[C@@]1(n2cnc3c(N)ncnc32)O[C@H](CO)[C@@H](O)[C@H]1O)(CC)CC |
| InChI | InChI=1S/C18H27N5O4Si/c1-4-28(5-2,6-3)8-7-18(15(26)14(25)12(9-24)27-18)23-11-22-13-16(19)20-10-21-17(13)23/h10-12,14-15,24-26H,4-6,9H2,1-3H3,(H2,19,20,21)/t12-,14-,15-,18-/m1/s1 |
| InChIKey | YRKZFNBVDJMZRB-SCFUHWHPSA-N |
| XLogP | 0.23 |
| TPSA | 139.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.53 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|