C16H18N6O4 — CID 67861348
(2R,3R,4S,5R)-2-(2-aminophenyl)-2-(6-aminopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 67861348) has the molecular formula C16H18N6O4 and a molecular weight of 358.36 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-(2-aminophenyl)-2-(6-aminopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-(2-aminophenyl)-2-(6-aminopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 67861348 |
| Molecular Formula | C16H18N6O4 |
| Molecular Weight | 358.36 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | (2R,3R,4S,5R)-2-(2-aminophenyl)-2-(6-aminopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | Nc1ccccc1[C@@]1(n2cnc3c(N)ncnc32)O[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C16H18N6O4/c17-9-4-2-1-3-8(9)16(13(25)12(24)10(5-23)26-16)22-7-21-11-14(18)19-6-20-15(11)22/h1-4,6-7,10,12-13,23-25H,5,17H2,(H2,18,19,20)/t10-,12-,13-,16-/m1/s1 |
| InChIKey | HVJMPZIYTRLEMV-XNIJJKJLSA-N |
| XLogP | -1.20 |
| TPSA | 165.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.36 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|