C20H27N5O4 — CID 68586747
(2R,3R,4S,5R)-2-(1-adamantyl)-2-(6-aminopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 68586747) has the molecular formula C20H27N5O4 and a molecular weight of 401.47 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-(1-adamantyl)-2-(6-aminopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-(1-adamantyl)-2-(6-aminopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 68586747 |
| Molecular Formula | C20H27N5O4 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.21 |
| IUPAC Name | (2R,3R,4S,5R)-2-(1-adamantyl)-2-(6-aminopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | Nc1ncnc2c1ncn2[C@]1(C23CC4CC(CC(C4)C2)C3)O[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C20H27N5O4/c21-17-14-18(23-8-22-17)25(9-24-14)20(16(28)15(27)13(7-26)29-20)19-4-10-1-11(5-19)3-12(2-10)6-19/h8-13,15-16,26-28H,1-7H2,(H2,21,22,23)/t10?,11?,12?,13-,15-,16-,19?,20+/m1/s1 |
| InChIKey | GTKLWYBEDOBUFL-KYMJUBTFSA-N |
| XLogP | 0.39 |
| TPSA | 139.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |