C18H31N5O5Si — CID 154429547
(2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-2-[2-[tert-butyl(dimethyl)silyl]-2-hydroxyethyl]-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 154429547) has the molecular formula C18H31N5O5Si and a molecular weight of 425.56 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-2-[2-[tert-butyl(dimethyl)silyl]-2-hydroxyethyl]-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-2-[2-[tert-butyl(dimethyl)silyl]-2-hydroxyethyl]-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 154429547 |
| Molecular Formula | C18H31N5O5Si |
| Molecular Weight | 425.56 g/mol |
| Exact Mass | 425.21 |
| IUPAC Name | (2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-2-[2-[tert-butyl(dimethyl)silyl]-2-hydroxyethyl]-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | CC(C)(C)[Si](C)(C)C(O)C[C@@]1(n2cnc3c(N)ncnc32)O[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C18H31N5O5Si/c1-17(2,3)29(4,5)11(25)6-18(14(27)13(26)10(7-24)28-18)23-9-22-12-15(19)20-8-21-16(12)23/h8-11,13-14,24-27H,6-7H2,1-5H3,(H2,19,20,21)/t10-,11?,13-,14-,18-/m1/s1 |
| InChIKey | XPNWNUBHRDYRDE-MUTOZGEKSA-N |
| XLogP | -0.03 |
| TPSA | 159.77 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.56 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|