C15H26N5O14P3 — CID 174874829
(2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-(hydroxymethyl)-2-(3-methylbut-3-enyl)oxolane-3,4-diol;diphosphono hydrogen phosphate (PubChem CID 174874829) has the molecular formula C15H26N5O14P3 and a molecular weight of 593.32 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-(hydroxymethyl)-2-(3-methylbut-3-enyl)oxolane-3,4-diol;diphosphono hydrogen phosphate.
| Compound Name | (2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-(hydroxymethyl)-2-(3-methylbut-3-enyl)oxolane-3,4-diol;diphosphono hydrogen phosphate |
|---|---|
| PubChem CID | 174874829 |
| Molecular Formula | C15H26N5O14P3 |
| Molecular Weight | 593.32 g/mol |
| Exact Mass | 593.07 |
| IUPAC Name | (2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-(hydroxymethyl)-2-(3-methylbut-3-enyl)oxolane-3,4-diol;diphosphono hydrogen phosphate |
| SMILES | C=C(C)CC[C@@]1(n2cnc3c(N)ncnc32)O[C@H](CO)[C@@H](O)[C@H]1O.O=P(O)(O)OP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C15H21N5O4.H5O10P3/c1-8(2)3-4-15(12(23)11(22)9(5-21)24-15)20-7-19-10-13(16)17-6-18-14(10)20;1-11(2,3)9-13(7,8)10-12(4,5)6/h6-7,9,11-12,21-23H,1,3-5H2,2H3,(H2,16,17,18);(H,7,8)(H2,1,2,3)(H2,4,5,6)/t9-,11-,12-,15-;/m1./s1 |
| InChIKey | SSHOGOPBCSWGRS-DNBRLMRSSA-N |
| XLogP | -1.16 |
| TPSA | 310.36 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.32 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|