C11H17N5O9P2S — CID 87114245
[(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-3-hydroxy-5-methyl-4-sulfanyloxolan-2-yl]methyl phosphono hydrogen phosphate (PubChem CID 87114245) has the molecular formula C11H17N5O9P2S and a molecular weight of 457.30 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-3-hydroxy-5-methyl-4-sulfanyloxolan-2-yl]methyl phosphono hydrogen phosphate.
| Compound Name | [(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-3-hydroxy-5-methyl-4-sulfanyloxolan-2-yl]methyl phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 87114245 |
| Molecular Formula | C11H17N5O9P2S |
| Molecular Weight | 457.30 g/mol |
| Exact Mass | 457.02 |
| IUPAC Name | [(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-3-hydroxy-5-methyl-4-sulfanyloxolan-2-yl]methyl phosphono hydrogen phosphate |
| SMILES | C[C@@]1(n2cnc3c(N)ncnc32)O[C@H](COP(=O)(O)OP(=O)(O)O)[C@@H](O)[C@H]1S |
| InChI | InChI=1S/C11H17N5O9P2S/c1-11(16-4-15-6-9(12)13-3-14-10(6)16)8(28)7(17)5(24-11)2-23-27(21,22)25-26(18,19)20/h3-5,7-8,17,28H,2H2,1H3,(H,21,22)(H2,12,13,14)(H2,18,19,20)/t5-,7-,8-,11-/m1/s1 |
| InChIKey | RMAIUDZGLFNEBV-IOSLPCCCSA-N |
| XLogP | -0.63 |
| TPSA | 212.37 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.30 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|