C15H24BrN5O15P2 — CID 129216990
[(2R,3S,4R,5S)-5-(6-aminopurin-9-yl)-5-bromo-3,4-dihydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate;(2R,3R,4R)-2,3,4,5-tetrahydroxypentanal (PubChem CID 129216990) has the molecular formula C15H24BrN5O15P2 and a molecular weight of 656.23 g/mol. Its IUPAC name is [(2R,3S,4R,5S)-5-(6-aminopurin-9-yl)-5-bromo-3,4-dihydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate;(2R,3R,4R)-2,3,4,5-tetrahydroxypentanal.
| Compound Name | [(2R,3S,4R,5S)-5-(6-aminopurin-9-yl)-5-bromo-3,4-dihydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate;(2R,3R,4R)-2,3,4,5-tetrahydroxypentanal |
|---|---|
| PubChem CID | 129216990 |
| Molecular Formula | C15H24BrN5O15P2 |
| Molecular Weight | 656.23 g/mol |
| Exact Mass | 654.99 |
| IUPAC Name | [(2R,3S,4R,5S)-5-(6-aminopurin-9-yl)-5-bromo-3,4-dihydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate;(2R,3R,4R)-2,3,4,5-tetrahydroxypentanal |
| SMILES | Nc1ncnc2c1ncn2[C@]1(Br)O[C@H](COP(=O)(O)OP(=O)(O)O)[C@@H](O)[C@H]1O.O=C[C@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C10H14BrN5O10P2.C5H10O5/c11-10(16-3-15-5-8(12)13-2-14-9(5)16)7(18)6(17)4(25-10)1-24-28(22,23)26-27(19,20)21;6-1-3(8)5(10)4(9)2-7/h2-4,6-7,17-18H,1H2,(H,22,23)(H2,12,13,14)(H2,19,20,21);1,3-5,7-10H,2H2/t4-,6-,7-,10+;3-,4+,5-/m10/s1 |
| InChIKey | VBKFHICHGKQWQX-QGQOKZQRSA-N |
| XLogP | -3.98 |
| TPSA | 330.59 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.23 |
| LogP ≤ 5 | -3.98 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|