C12H18N5O12P3 — CID 167655789
[[(1S,2R,3R,4S,5S)-5-(6-aminopurin-9-yl)-3,4-dihydroxy-2-bicyclo[3.1.0]hexanyl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 167655789) has the molecular formula C12H18N5O12P3 and a molecular weight of 517.22 g/mol. Its IUPAC name is [[(1S,2R,3R,4S,5S)-5-(6-aminopurin-9-yl)-3,4-dihydroxy-2-bicyclo[3.1.0]hexanyl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(1S,2R,3R,4S,5S)-5-(6-aminopurin-9-yl)-3,4-dihydroxy-2-bicyclo[3.1.0]hexanyl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 167655789 |
| Molecular Formula | C12H18N5O12P3 |
| Molecular Weight | 517.22 g/mol |
| Exact Mass | 517.02 |
| IUPAC Name | [[(1S,2R,3R,4S,5S)-5-(6-aminopurin-9-yl)-3,4-dihydroxy-2-bicyclo[3.1.0]hexanyl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | Nc1ncnc2c1ncn2[C@@]12C[C@H]1[C@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[C@@H](O)[C@H]2O |
| InChI | InChI=1S/C12H18N5O12P3/c13-10-7-11(15-3-14-10)17(4-16-7)12-1-6(12)5(8(18)9(12)19)2-27-31(23,24)29-32(25,26)28-30(20,21)22/h3-6,8-9,18-19H,1-2H2,(H,23,24)(H,25,26)(H2,13,14,15)(H2,20,21,22)/t5-,6-,8+,9+,12-/m0/s1 |
| InChIKey | YTVCBLCFJNVJPP-CEQXEPLDSA-N |
| XLogP | -1.18 |
| TPSA | 269.90 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.22 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|