C12H18N5O13P3 — CID 87894115
[5-(6-aminopurin-9-yl)-2,3-dihydroxy-1-bicyclo[3.1.0]hexanyl]methoxy [hydroxy(phosphonooxy)phosphoryl] hydrogen phosphate (PubChem CID 87894115) has the molecular formula C12H18N5O13P3 and a molecular weight of 533.22 g/mol. Its IUPAC name is [5-(6-aminopurin-9-yl)-2,3-dihydroxy-1-bicyclo[3.1.0]hexanyl]methoxy [hydroxy(phosphonooxy)phosphoryl] hydrogen phosphate.
| Compound Name | [5-(6-aminopurin-9-yl)-2,3-dihydroxy-1-bicyclo[3.1.0]hexanyl]methoxy [hydroxy(phosphonooxy)phosphoryl] hydrogen phosphate |
|---|---|
| PubChem CID | 87894115 |
| Molecular Formula | C12H18N5O13P3 |
| Molecular Weight | 533.22 g/mol |
| Exact Mass | 533.01 |
| IUPAC Name | [5-(6-aminopurin-9-yl)-2,3-dihydroxy-1-bicyclo[3.1.0]hexanyl]methoxy [hydroxy(phosphonooxy)phosphoryl] hydrogen phosphate |
| SMILES | Nc1ncnc2c1ncn2C12CC(O)C(O)C1(COOP(=O)(O)OP(=O)(O)OP(=O)(O)O)C2 |
| InChI | InChI=1S/C12H18N5O13P3/c13-9-7-10(15-4-14-9)17(5-16-7)12-1-6(18)8(19)11(12,2-12)3-27-28-32(23,24)30-33(25,26)29-31(20,21)22/h4-6,8,18-19H,1-3H2,(H,23,24)(H,25,26)(H2,13,14,15)(H2,20,21,22) |
| InChIKey | YBNXKDJFBPNQEU-UHFFFAOYSA-N |
| XLogP | -1.11 |
| TPSA | 279.13 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.22 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|