C5H8N5NaO7P2 — CID 173307525
sodium;(6-aminopurin-9-yl) phosphono hydrogen phosphate;hydride (PubChem CID 173307525) has the molecular formula C5H8N5NaO7P2 and a molecular weight of 335.09 g/mol. Its IUPAC name is sodium;(6-aminopurin-9-yl) phosphono hydrogen phosphate;hydride.
| Compound Name | sodium;(6-aminopurin-9-yl) phosphono hydrogen phosphate;hydride |
|---|---|
| PubChem CID | 173307525 |
| Molecular Formula | C5H8N5NaO7P2 |
| Molecular Weight | 335.09 g/mol |
| Exact Mass | 334.98 |
| IUPAC Name | sodium;(6-aminopurin-9-yl) phosphono hydrogen phosphate;hydride |
| SMILES | Nc1ncnc2c1ncn2OP(=O)(O)OP(=O)(O)O.[H-].[Na+] |
| InChI | InChI=1S/C5H7N5O7P2.Na.H/c6-4-3-5(8-1-7-4)10(2-9-3)16-19(14,15)17-18(11,12)13;;/h1-2H,(H,14,15)(H2,6,7,8)(H2,11,12,13);;/q;+1;-1 |
| InChIKey | FXGIVLITMDGCGR-UHFFFAOYSA-N |
| XLogP | -3.84 |
| TPSA | 182.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.09 |
| LogP ≤ 5 | -3.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|