C5H9N6O10P3 — CID 87195963
(2,6-diaminopurin-9-yl) [hydroxy(phosphonooxy)phosphoryl] hydrogen phosphate (PubChem CID 87195963) has the molecular formula C5H9N6O10P3 and a molecular weight of 406.08 g/mol. Its IUPAC name is (2,6-diaminopurin-9-yl) [hydroxy(phosphonooxy)phosphoryl] hydrogen phosphate.
| Compound Name | (2,6-diaminopurin-9-yl) [hydroxy(phosphonooxy)phosphoryl] hydrogen phosphate |
|---|---|
| PubChem CID | 87195963 |
| Molecular Formula | C5H9N6O10P3 |
| Molecular Weight | 406.08 g/mol |
| Exact Mass | 405.96 |
| IUPAC Name | (2,6-diaminopurin-9-yl) [hydroxy(phosphonooxy)phosphoryl] hydrogen phosphate |
| SMILES | Nc1nc(N)c2ncn(OP(=O)(O)OP(=O)(O)OP(=O)(O)O)c2n1 |
| InChI | InChI=1S/C5H9N6O10P3/c6-3-2-4(10-5(7)9-3)11(1-8-2)19-23(15,16)21-24(17,18)20-22(12,13)14/h1H,(H,15,16)(H,17,18)(H2,12,13,14)(H4,6,7,9,10) |
| InChIKey | QFNGINWTGHXCAR-UHFFFAOYSA-N |
| XLogP | -1.25 |
| TPSA | 255.46 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.08 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|