C10H16N9O11P3 — CID 56683772
[[(2R,3R,5S)-3-azido-5-(2,6-diaminopurin-9-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 56683772) has the molecular formula C10H16N9O11P3 and a molecular weight of 531.21 g/mol. Its IUPAC name is [[(2R,3R,5S)-3-azido-5-(2,6-diaminopurin-9-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,3R,5S)-3-azido-5-(2,6-diaminopurin-9-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 56683772 |
| Molecular Formula | C10H16N9O11P3 |
| Molecular Weight | 531.21 g/mol |
| Exact Mass | 531.02 |
| IUPAC Name | [[(2R,3R,5S)-3-azido-5-(2,6-diaminopurin-9-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | [N-]=[N+]=N[C@@H]1C[C@@H](n2cnc3c(N)nc(N)nc32)O[C@H]1COP(=O)(O)OP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C10H16N9O11P3/c11-8-7-9(16-10(12)15-8)19(3-14-7)6-1-4(17-18-13)5(28-6)2-27-32(23,24)30-33(25,26)29-31(20,21)22/h3-6H,1-2H2,(H,23,24)(H,25,26)(H2,20,21,22)(H4,11,12,15,16)/t4-,5+,6+/m1/s1 |
| InChIKey | RHFGAAAATPJJFE-SRQIZXRXSA-N |
| XLogP | 0.30 |
| TPSA | 313.45 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.21 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|