C12H17N9O2 — CID 19875293
[5-[2-amino-6-(dimethylamino)purin-9-yl]-3-azidooxolan-2-yl]methanol (PubChem CID 19875293) has the molecular formula C12H17N9O2 and a molecular weight of 319.33 g/mol. Its IUPAC name is [5-[2-amino-6-(dimethylamino)purin-9-yl]-3-azidooxolan-2-yl]methanol.
| Compound Name | [5-[2-amino-6-(dimethylamino)purin-9-yl]-3-azidooxolan-2-yl]methanol |
|---|---|
| PubChem CID | 19875293 |
| Molecular Formula | C12H17N9O2 |
| Molecular Weight | 319.33 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | [5-[2-amino-6-(dimethylamino)purin-9-yl]-3-azidooxolan-2-yl]methanol |
| SMILES | CN(C)c1nc(N)nc2c1ncn2C1CC(N=[N+]=[N-])C(CO)O1 |
| InChI | InChI=1S/C12H17N9O2/c1-20(2)10-9-11(17-12(13)16-10)21(5-15-9)8-3-6(18-19-14)7(4-22)23-8/h5-8,22H,3-4H2,1-2H3,(H2,13,16,17) |
| InChIKey | DFJXOUXQJVZGDD-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 151.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.33 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|