C13H19N9O2 — CID 19875305
[5-[2-amino-6-(propylamino)purin-9-yl]-3-azidooxolan-2-yl]methanol (PubChem CID 19875305) has the molecular formula C13H19N9O2 and a molecular weight of 333.36 g/mol. Its IUPAC name is [5-[2-amino-6-(propylamino)purin-9-yl]-3-azidooxolan-2-yl]methanol.
| Compound Name | [5-[2-amino-6-(propylamino)purin-9-yl]-3-azidooxolan-2-yl]methanol |
|---|---|
| PubChem CID | 19875305 |
| Molecular Formula | C13H19N9O2 |
| Molecular Weight | 333.36 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | [5-[2-amino-6-(propylamino)purin-9-yl]-3-azidooxolan-2-yl]methanol |
| SMILES | CCCNc1nc(N)nc2c1ncn2C1CC(N=[N+]=[N-])C(CO)O1 |
| InChI | InChI=1S/C13H19N9O2/c1-2-3-16-11-10-12(19-13(14)18-11)22(6-17-10)9-4-7(20-21-15)8(5-23)24-9/h6-9,23H,2-5H2,1H3,(H3,14,16,18,19) |
| InChIKey | VGPTVLPJUCPPCR-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 159.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.36 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|