C17H19FN6O2 — CID 67703950
[(2R,3S,5R)-5-[2-amino-6-(benzylamino)purin-9-yl]-3-fluorooxolan-2-yl]methanol (PubChem CID 67703950) has the molecular formula C17H19FN6O2 and a molecular weight of 358.38 g/mol. Its IUPAC name is [(2R,3S,5R)-5-[2-amino-6-(benzylamino)purin-9-yl]-3-fluorooxolan-2-yl]methanol.
| Compound Name | [(2R,3S,5R)-5-[2-amino-6-(benzylamino)purin-9-yl]-3-fluorooxolan-2-yl]methanol |
|---|---|
| PubChem CID | 67703950 |
| Molecular Formula | C17H19FN6O2 |
| Molecular Weight | 358.38 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | [(2R,3S,5R)-5-[2-amino-6-(benzylamino)purin-9-yl]-3-fluorooxolan-2-yl]methanol |
| SMILES | Nc1nc(NCc2ccccc2)c2ncn([C@H]3C[C@H](F)[C@@H](CO)O3)c2n1 |
| InChI | InChI=1S/C17H19FN6O2/c18-11-6-13(26-12(11)8-25)24-9-21-14-15(22-17(19)23-16(14)24)20-7-10-4-2-1-3-5-10/h1-5,9,11-13,25H,6-8H2,(H3,19,20,22,23)/t11-,12+,13+/m0/s1 |
| InChIKey | CPUPTMSGKQERQV-YNEHKIRRSA-N |
| XLogP | 1.64 |
| TPSA | 111.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.38 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |