C14H20ClN5O3 — CID 10042975
(2R,3S,5R)-5-[6-(butylamino)-2-chloropurin-9-yl]-2-(hydroxymethyl)oxolan-3-ol (PubChem CID 10042975) has the molecular formula C14H20ClN5O3 and a molecular weight of 341.80 g/mol. Its IUPAC name is (2R,3S,5R)-5-[6-(butylamino)-2-chloropurin-9-yl]-2-(hydroxymethyl)oxolan-3-ol.
| Compound Name | (2R,3S,5R)-5-[6-(butylamino)-2-chloropurin-9-yl]-2-(hydroxymethyl)oxolan-3-ol |
|---|---|
| PubChem CID | 10042975 |
| Molecular Formula | C14H20ClN5O3 |
| Molecular Weight | 341.80 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | (2R,3S,5R)-5-[6-(butylamino)-2-chloropurin-9-yl]-2-(hydroxymethyl)oxolan-3-ol |
| SMILES | CCCCNc1nc(Cl)nc2c1ncn2[C@H]1C[C@H](O)[C@@H](CO)O1 |
| InChI | InChI=1S/C14H20ClN5O3/c1-2-3-4-16-12-11-13(19-14(15)18-12)20(7-17-11)10-5-8(22)9(6-21)23-10/h7-10,21-22H,2-6H2,1H3,(H,16,18,19)/t8-,9+,10+/m0/s1 |
| InChIKey | AHUPRCDPLAJPDR-IVZWLZJFSA-N |
| XLogP | 1.33 |
| TPSA | 105.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.80 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|