C25H35N5O3 — CID 23586674
2-ethyl-5-[6-(heptylamino)-2-phenylmethoxypurin-9-yl]oxolan-3-ol (PubChem CID 23586674) has the molecular formula C25H35N5O3 and a molecular weight of 453.59 g/mol. Its IUPAC name is 2-ethyl-5-[6-(heptylamino)-2-phenylmethoxypurin-9-yl]oxolan-3-ol.
| Compound Name | 2-ethyl-5-[6-(heptylamino)-2-phenylmethoxypurin-9-yl]oxolan-3-ol |
|---|---|
| PubChem CID | 23586674 |
| Molecular Formula | C25H35N5O3 |
| Molecular Weight | 453.59 g/mol |
| Exact Mass | 453.27 |
| IUPAC Name | 2-ethyl-5-[6-(heptylamino)-2-phenylmethoxypurin-9-yl]oxolan-3-ol |
| SMILES | CCCCCCCNc1nc(OCc2ccccc2)nc2c1ncn2C1CC(O)C(CC)O1 |
| InChI | InChI=1S/C25H35N5O3/c1-3-5-6-7-11-14-26-23-22-24(29-25(28-23)32-16-18-12-9-8-10-13-18)30(17-27-22)21-15-19(31)20(4-2)33-21/h8-10,12-13,17,19-21,31H,3-7,11,14-16H2,1-2H3,(H,26,28,29) |
| InChIKey | WLACEMDOEHMNFL-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 94.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.59 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|