C19H31N5O — CID 58855570
9-[(2R,5R)-5-ethyl-4-methyloxolan-2-yl]-N-heptylpurin-6-amine (PubChem CID 58855570) has the molecular formula C19H31N5O and a molecular weight of 345.49 g/mol. Its IUPAC name is 9-[(2R,5R)-5-ethyl-4-methyloxolan-2-yl]-N-heptylpurin-6-amine.
| Compound Name | 9-[(2R,5R)-5-ethyl-4-methyloxolan-2-yl]-N-heptylpurin-6-amine |
|---|---|
| PubChem CID | 58855570 |
| Molecular Formula | C19H31N5O |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.25 |
| IUPAC Name | 9-[(2R,5R)-5-ethyl-4-methyloxolan-2-yl]-N-heptylpurin-6-amine |
| SMILES | CCCCCCCNc1ncnc2c1ncn2[C@H]1CC(C)[C@@H](CC)O1 |
| InChI | InChI=1S/C19H31N5O/c1-4-6-7-8-9-10-20-18-17-19(22-12-21-18)24(13-23-17)16-11-14(3)15(5-2)25-16/h12-16H,4-11H2,1-3H3,(H,20,21,22)/t14?,15-,16-/m1/s1 |
| InChIKey | QDXPXRFBDWBODR-ANGDWKNPSA-N |
| XLogP | 4.54 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|