C35H44N6O5 — CID 118147529
9H-fluoren-9-ylmethyl N-[4-[[9-[(2R,5R)-5-(hydroxymethyl)-4-pentoxyoxolan-2-yl]purin-6-yl]amino]butyl]-N-methylcarbamate (PubChem CID 118147529) has the molecular formula C35H44N6O5 and a molecular weight of 628.77 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[4-[[9-[(2R,5R)-5-(hydroxymethyl)-4-pentoxyoxolan-2-yl]purin-6-yl]amino]butyl]-N-methylcarbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[4-[[9-[(2R,5R)-5-(hydroxymethyl)-4-pentoxyoxolan-2-yl]purin-6-yl]amino]butyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 118147529 |
| Molecular Formula | C35H44N6O5 |
| Molecular Weight | 628.77 g/mol |
| Exact Mass | 628.34 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[4-[[9-[(2R,5R)-5-(hydroxymethyl)-4-pentoxyoxolan-2-yl]purin-6-yl]amino]butyl]-N-methylcarbamate |
| SMILES | CCCCCOC1C[C@H](n2cnc3c(NCCCCN(C)C(=O)OCC4c5ccccc5-c5ccccc54)ncnc32)O[C@@H]1CO |
| InChI | InChI=1S/C35H44N6O5/c1-3-4-11-18-44-29-19-31(46-30(29)20-42)41-23-39-32-33(37-22-38-34(32)41)36-16-9-10-17-40(2)35(43)45-21-28-26-14-7-5-12-24(26)25-13-6-8-15-27(25)28/h5-8,12-15,22-23,28-31,42H,3-4,9-11,16-21H2,1-2H3,(H,36,37,38)/t29?,30-,31-/m1/s1 |
| InChIKey | NKVBLCSWVJPAPR-DGRDJXPTSA-N |
| XLogP | 5.75 |
| TPSA | 123.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.77 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|