C32H36N6O5 — CID 72947065
9H-fluoren-9-ylmethyl N-[(E)-7-[(2R,3S,5R)-5-(6-aminopurin-9-yl)-2-(hydroxymethyl)oxolan-3-yl]oxyhept-5-enyl]carbamate (PubChem CID 72947065) has the molecular formula C32H36N6O5 and a molecular weight of 584.68 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[(E)-7-[(2R,3S,5R)-5-(6-aminopurin-9-yl)-2-(hydroxymethyl)oxolan-3-yl]oxyhept-5-enyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[(E)-7-[(2R,3S,5R)-5-(6-aminopurin-9-yl)-2-(hydroxymethyl)oxolan-3-yl]oxyhept-5-enyl]carbamate |
|---|---|
| PubChem CID | 72947065 |
| Molecular Formula | C32H36N6O5 |
| Molecular Weight | 584.68 g/mol |
| Exact Mass | 584.27 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[(E)-7-[(2R,3S,5R)-5-(6-aminopurin-9-yl)-2-(hydroxymethyl)oxolan-3-yl]oxyhept-5-enyl]carbamate |
| SMILES | Nc1ncnc2c1ncn2[C@H]1C[C@H](OC/C=C/CCCCNC(=O)OCC2c3ccccc3-c3ccccc32)[C@@H](CO)O1 |
| InChI | InChI=1S/C32H36N6O5/c33-30-29-31(36-19-35-30)38(20-37-29)28-16-26(27(17-39)43-28)41-15-9-3-1-2-8-14-34-32(40)42-18-25-23-12-6-4-10-21(23)22-11-5-7-13-24(22)25/h3-7,9-13,19-20,25-28,39H,1-2,8,14-18H2,(H,34,40)(H2,33,35,36)/b9-3+/t26-,27+,28+/m0/s1 |
| InChIKey | WAPPKRXKWOQUHR-KLIXVUCSSA-N |
| XLogP | 4.34 |
| TPSA | 146.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.68 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|