C51H50N6O7 — CID 70861996
9H-fluoren-9-ylmethyl N-[4-[[9-[(2R,5S)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]oxolan-2-yl]purin-6-yl]amino]-4-oxobutyl]-N-methylcarbamate (PubChem CID 70861996) has the molecular formula C51H50N6O7 and a molecular weight of 859.00 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[4-[[9-[(2R,5S)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]oxolan-2-yl]purin-6-yl]amino]-4-oxobutyl]-N-methylcarbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[4-[[9-[(2R,5S)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]oxolan-2-yl]purin-6-yl]amino]-4-oxobutyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 70861996 |
| Molecular Formula | C51H50N6O7 |
| Molecular Weight | 859.00 g/mol |
| Exact Mass | 858.37 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[4-[[9-[(2R,5S)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]oxolan-2-yl]purin-6-yl]amino]-4-oxobutyl]-N-methylcarbamate |
| SMILES | COc1ccc(C(OC[C@@H]2CC[C@H](n3cnc4c(NC(=O)CCCN(C)C(=O)OCC5c6ccccc6-c6ccccc65)ncnc43)O2)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C51H50N6O7/c1-56(50(59)62-31-44-42-16-9-7-14-40(42)41-15-8-10-17-43(41)44)29-11-18-45(58)55-48-47-49(53-32-52-48)57(33-54-47)46-28-27-39(64-46)30-63-51(34-12-5-4-6-13-34,35-19-23-37(60-2)24-20-35)36-21-25-38(61-3)26-22-36/h4-10,12-17,19-26,32-33,39,44,46H,11,18,27-31H2,1-3H3,(H,52,53,55,58)/t39-,46+/m0/s1 |
| InChIKey | JAXLDQGXXXZFBD-MWMZBTOCSA-N |
| XLogP | 9.13 |
| TPSA | 139.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 64 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 859.00 |
| LogP ≤ 5 | 9.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|