C34H36N4O5 — CID 166650073
9-[(2R,5S)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]oxolan-2-yl]-1-propylpurin-6-one (PubChem CID 166650073) has the molecular formula C34H36N4O5 and a molecular weight of 580.69 g/mol. Its IUPAC name is 9-[(2R,5S)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]oxolan-2-yl]-1-propylpurin-6-one.
| Compound Name | 9-[(2R,5S)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]oxolan-2-yl]-1-propylpurin-6-one |
|---|---|
| PubChem CID | 166650073 |
| Molecular Formula | C34H36N4O5 |
| Molecular Weight | 580.69 g/mol |
| Exact Mass | 580.27 |
| IUPAC Name | 9-[(2R,5S)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]oxolan-2-yl]-1-propylpurin-6-one |
| SMILES | CCCn1cnc2c(ncn2[C@H]2CC[C@@H](COC(c3ccccc3)(c3ccc(OC)cc3)c3ccc(OC)cc3)O2)c1=O |
| InChI | InChI=1S/C34H36N4O5/c1-4-20-37-22-36-32-31(33(37)39)35-23-38(32)30-19-18-29(43-30)21-42-34(24-8-6-5-7-9-24,25-10-14-27(40-2)15-11-25)26-12-16-28(41-3)17-13-26/h5-17,22-23,29-30H,4,18-21H2,1-3H3/t29-,30+/m0/s1 |
| InChIKey | ZQBJSCMQJYEHNB-XZWHSSHBSA-N |
| XLogP | 5.71 |
| TPSA | 89.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.69 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|