C31H34N2O6 — CID 4182704
3-[5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]oxolan-2-yl]-2-hydroxy-5-methyl-1,2-dihydropyrimidin-6-one (PubChem CID 4182704) has the molecular formula C31H34N2O6 and a molecular weight of 530.62 g/mol. Its IUPAC name is 3-[5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]oxolan-2-yl]-2-hydroxy-5-methyl-1,2-dihydropyrimidin-6-one.
| Compound Name | 3-[5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]oxolan-2-yl]-2-hydroxy-5-methyl-1,2-dihydropyrimidin-6-one |
|---|---|
| PubChem CID | 4182704 |
| Molecular Formula | C31H34N2O6 |
| Molecular Weight | 530.62 g/mol |
| Exact Mass | 530.24 |
| IUPAC Name | 3-[5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]oxolan-2-yl]-2-hydroxy-5-methyl-1,2-dihydropyrimidin-6-one |
| SMILES | COc1ccc(C(OCC2CCC(N3C=C(C)C(=O)NC3O)O2)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C31H34N2O6/c1-21-19-33(30(35)32-29(21)34)28-18-17-27(39-28)20-38-31(22-7-5-4-6-8-22,23-9-13-25(36-2)14-10-23)24-11-15-26(37-3)16-12-24/h4-16,19,27-28,30,35H,17-18,20H2,1-3H3,(H,32,34) |
| InChIKey | JIMHLKLLMBWWMY-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 89.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.62 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|