C34H35N3O6 — CID 168820151
1-[(2R,6S)-6-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-prop-2-ynylmorpholin-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 168820151) has the molecular formula C34H35N3O6 and a molecular weight of 581.67 g/mol. Its IUPAC name is 1-[(2R,6S)-6-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-prop-2-ynylmorpholin-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(2R,6S)-6-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-prop-2-ynylmorpholin-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 168820151 |
| Molecular Formula | C34H35N3O6 |
| Molecular Weight | 581.67 g/mol |
| Exact Mass | 581.25 |
| IUPAC Name | 1-[(2R,6S)-6-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-prop-2-ynylmorpholin-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | C#CCN1C[C@@H](COC(c2ccccc2)(c2ccc(OC)cc2)c2ccc(OC)cc2)O[C@@H](n2cc(C)c(=O)[nH]c2=O)C1 |
| InChI | InChI=1S/C34H35N3O6/c1-5-19-36-21-30(43-31(22-36)37-20-24(2)32(38)35-33(37)39)23-42-34(25-9-7-6-8-10-25,26-11-15-28(40-3)16-12-26)27-13-17-29(41-4)18-14-27/h1,6-18,20,30-31H,19,21-23H2,2-4H3,(H,35,38,39)/t30-,31+/m0/s1 |
| InChIKey | MVBCVZLCHYMUDA-IOWSJCHKSA-N |
| XLogP | 3.70 |
| TPSA | 95.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.67 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|