C36H41N5O6 — CID 136502530
9-[5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]oxolan-2-yl]-2-[(2-hydroxy-3-methylbutan-2-yl)amino]-1H-purin-6-one (PubChem CID 136502530) has the molecular formula C36H41N5O6 and a molecular weight of 639.75 g/mol. Its IUPAC name is 9-[5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]oxolan-2-yl]-2-[(2-hydroxy-3-methylbutan-2-yl)amino]-1H-purin-6-one.
| Compound Name | 9-[5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]oxolan-2-yl]-2-[(2-hydroxy-3-methylbutan-2-yl)amino]-1H-purin-6-one |
|---|---|
| PubChem CID | 136502530 |
| Molecular Formula | C36H41N5O6 |
| Molecular Weight | 639.75 g/mol |
| Exact Mass | 639.31 |
| IUPAC Name | 9-[5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]oxolan-2-yl]-2-[(2-hydroxy-3-methylbutan-2-yl)amino]-1H-purin-6-one |
| SMILES | COc1ccc(C(OCC2CCC(n3cnc4c(=O)[nH]c(NC(C)(O)C(C)C)nc43)O2)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C36H41N5O6/c1-23(2)35(3,43)40-34-38-32-31(33(42)39-34)37-22-41(32)30-20-19-29(47-30)21-46-36(24-9-7-6-8-10-24,25-11-15-27(44-4)16-12-25)26-13-17-28(45-5)18-14-26/h6-18,22-23,29-30,43H,19-21H2,1-5H3,(H2,38,39,40,42) |
| InChIKey | QNVBYXYWWQOYPY-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 132.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.75 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|