C39H44N6O7 — CID 148573281
N-ethyl-N'-[9-[(2R,5S)-5-[[[4-(hydroxymethyl)phenyl]-(4-methoxyphenyl)-phenylmethoxy]methyl]oxolan-2-yl]-6-oxo-1H-purin-2-yl]hexanediamide (PubChem CID 148573281) has the molecular formula C39H44N6O7 and a molecular weight of 708.82 g/mol. Its IUPAC name is N-ethyl-N'-[9-[(2R,5S)-5-[[[4-(hydroxymethyl)phenyl]-(4-methoxyphenyl)-phenylmethoxy]methyl]oxolan-2-yl]-6-oxo-1H-purin-2-yl]hexanediamide.
| Compound Name | N-ethyl-N'-[9-[(2R,5S)-5-[[[4-(hydroxymethyl)phenyl]-(4-methoxyphenyl)-phenylmethoxy]methyl]oxolan-2-yl]-6-oxo-1H-purin-2-yl]hexanediamide |
|---|---|
| PubChem CID | 148573281 |
| Molecular Formula | C39H44N6O7 |
| Molecular Weight | 708.82 g/mol |
| Exact Mass | 708.33 |
| IUPAC Name | N-ethyl-N'-[9-[(2R,5S)-5-[[[4-(hydroxymethyl)phenyl]-(4-methoxyphenyl)-phenylmethoxy]methyl]oxolan-2-yl]-6-oxo-1H-purin-2-yl]hexanediamide |
| SMILES | CCNC(=O)CCCCC(=O)Nc1nc2c(ncn2[C@H]2CC[C@@H](COC(c3ccccc3)(c3ccc(CO)cc3)c3ccc(OC)cc3)O2)c(=O)[nH]1 |
| InChI | InChI=1S/C39H44N6O7/c1-3-40-32(47)11-7-8-12-33(48)42-38-43-36-35(37(49)44-38)41-25-45(36)34-22-21-31(52-34)24-51-39(27-9-5-4-6-10-27,28-15-13-26(23-46)14-16-28)29-17-19-30(50-2)20-18-29/h4-6,9-10,13-20,25,31,34,46H,3,7-8,11-12,21-24H2,1-2H3,(H,40,47)(H2,42,43,44,48,49)/t31-,34+,39?/m0/s1 |
| InChIKey | MXHIVLYEQZFGMX-GNKAQVQWSA-N |
| XLogP | 4.94 |
| TPSA | 169.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 52 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.82 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|