C25H26N6O5S — CID 15450862
N-[(9S,10S)-10-[[9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]amino]-9,10-dihydrophenanthren-9-yl]methanesulfonamide (PubChem CID 15450862) has the molecular formula C25H26N6O5S and a molecular weight of 522.59 g/mol. Its IUPAC name is N-[(9S,10S)-10-[[9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]amino]-9,10-dihydrophenanthren-9-yl]methanesulfonamide.
| Compound Name | N-[(9S,10S)-10-[[9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]amino]-9,10-dihydrophenanthren-9-yl]methanesulfonamide |
|---|---|
| PubChem CID | 15450862 |
| Molecular Formula | C25H26N6O5S |
| Molecular Weight | 522.59 g/mol |
| Exact Mass | 522.17 |
| IUPAC Name | N-[(9S,10S)-10-[[9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]amino]-9,10-dihydrophenanthren-9-yl]methanesulfonamide |
| SMILES | CS(=O)(=O)N[C@H]1c2ccccc2-c2ccccc2[C@@H]1Nc1ncnc2c1ncn2[C@H]1C[C@H](O)[C@@H](CO)O1 |
| InChI | InChI=1S/C25H26N6O5S/c1-37(34,35)30-22-17-9-5-3-7-15(17)14-6-2-4-8-16(14)21(22)29-24-23-25(27-12-26-24)31(13-28-23)20-10-18(33)19(11-32)36-20/h2-9,12-13,18-22,30,32-33H,10-11H2,1H3,(H,26,27,29)/t18-,19+,20+,21-,22-/m0/s1 |
| InChIKey | QFTAKKXKRJLXTJ-MNVIUDHYSA-N |
| XLogP | 1.89 |
| TPSA | 151.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.59 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |