C17H19N5O4 — CID 11164166
(2R,3S,5R)-2-(hydroxymethyl)-5-[6-(4-methoxyanilino)purin-9-yl]oxolan-3-ol (PubChem CID 11164166) has the molecular formula C17H19N5O4 and a molecular weight of 357.37 g/mol. Its IUPAC name is (2R,3S,5R)-2-(hydroxymethyl)-5-[6-(4-methoxyanilino)purin-9-yl]oxolan-3-ol.
| Compound Name | (2R,3S,5R)-2-(hydroxymethyl)-5-[6-(4-methoxyanilino)purin-9-yl]oxolan-3-ol |
|---|---|
| PubChem CID | 11164166 |
| Molecular Formula | C17H19N5O4 |
| Molecular Weight | 357.37 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | (2R,3S,5R)-2-(hydroxymethyl)-5-[6-(4-methoxyanilino)purin-9-yl]oxolan-3-ol |
| SMILES | COc1ccc(Nc2ncnc3c2ncn3[C@H]2C[C@H](O)[C@@H](CO)O2)cc1 |
| InChI | InChI=1S/C17H19N5O4/c1-25-11-4-2-10(3-5-11)21-16-15-17(19-8-18-16)22(9-20-15)14-6-12(24)13(7-23)26-14/h2-5,8-9,12-14,23-24H,6-7H2,1H3,(H,18,19,21)/t12-,13+,14+/m0/s1 |
| InChIKey | YPWJNDUJJHVHKM-BFHYXJOUSA-N |
| XLogP | 1.22 |
| TPSA | 114.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.37 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |