C22H23N5O3 — CID 70913002
(2R,5R)-2-(hydroxymethyl)-5-[6-(1-naphthalen-2-ylethylamino)purin-9-yl]oxolan-3-ol (PubChem CID 70913002) has the molecular formula C22H23N5O3 and a molecular weight of 405.46 g/mol. Its IUPAC name is (2R,5R)-2-(hydroxymethyl)-5-[6-(1-naphthalen-2-ylethylamino)purin-9-yl]oxolan-3-ol.
| Compound Name | (2R,5R)-2-(hydroxymethyl)-5-[6-(1-naphthalen-2-ylethylamino)purin-9-yl]oxolan-3-ol |
|---|---|
| PubChem CID | 70913002 |
| Molecular Formula | C22H23N5O3 |
| Molecular Weight | 405.46 g/mol |
| Exact Mass | 405.18 |
| IUPAC Name | (2R,5R)-2-(hydroxymethyl)-5-[6-(1-naphthalen-2-ylethylamino)purin-9-yl]oxolan-3-ol |
| SMILES | CC(Nc1ncnc2c1ncn2[C@H]1CC(O)[C@@H](CO)O1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C22H23N5O3/c1-13(15-7-6-14-4-2-3-5-16(14)8-15)26-21-20-22(24-11-23-21)27(12-25-20)19-9-17(29)18(10-28)30-19/h2-8,11-13,17-19,28-29H,9-10H2,1H3,(H,23,24,26)/t13?,17?,18-,19-/m1/s1 |
| InChIKey | JUVWOVMJYALPHO-QAZKEQNZSA-N |
| XLogP | 2.79 |
| TPSA | 105.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.46 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |