C23H21N5O3 — CID 70913001
(2R,5S)-2-[6-(9H-fluoren-9-ylamino)purin-9-yl]-5-(hydroxymethyl)oxolan-3-ol (PubChem CID 70913001) has the molecular formula C23H21N5O3 and a molecular weight of 415.45 g/mol. Its IUPAC name is (2R,5S)-2-[6-(9H-fluoren-9-ylamino)purin-9-yl]-5-(hydroxymethyl)oxolan-3-ol.
| Compound Name | (2R,5S)-2-[6-(9H-fluoren-9-ylamino)purin-9-yl]-5-(hydroxymethyl)oxolan-3-ol |
|---|---|
| PubChem CID | 70913001 |
| Molecular Formula | C23H21N5O3 |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | (2R,5S)-2-[6-(9H-fluoren-9-ylamino)purin-9-yl]-5-(hydroxymethyl)oxolan-3-ol |
| SMILES | OC[C@@H]1CC(O)[C@H](n2cnc3c(NC4c5ccccc5-c5ccccc54)ncnc32)O1 |
| InChI | InChI=1S/C23H21N5O3/c29-10-13-9-18(30)23(31-13)28-12-26-20-21(24-11-25-22(20)28)27-19-16-7-3-1-5-14(16)15-6-2-4-8-17(15)19/h1-8,11-13,18-19,23,29-30H,9-10H2,(H,24,25,27)/t13-,18?,23+/m0/s1 |
| InChIKey | PNFOTPHAOISULJ-HLOFHJQFSA-N |
| XLogP | 2.65 |
| TPSA | 105.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |