C21H23FN6O4 — CID 87830197
3-fluoro-2-[3-[[9-[(2R,3R,5S)-3-hydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]amino]pyrrolidin-1-yl]benzaldehyde (PubChem CID 87830197) has the molecular formula C21H23FN6O4 and a molecular weight of 442.45 g/mol. Its IUPAC name is 3-fluoro-2-[3-[[9-[(2R,3R,5S)-3-hydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]amino]pyrrolidin-1-yl]benzaldehyde.
| Compound Name | 3-fluoro-2-[3-[[9-[(2R,3R,5S)-3-hydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]amino]pyrrolidin-1-yl]benzaldehyde |
|---|---|
| PubChem CID | 87830197 |
| Molecular Formula | C21H23FN6O4 |
| Molecular Weight | 442.45 g/mol |
| Exact Mass | 442.18 |
| IUPAC Name | 3-fluoro-2-[3-[[9-[(2R,3R,5S)-3-hydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]amino]pyrrolidin-1-yl]benzaldehyde |
| SMILES | O=Cc1cccc(F)c1N1CCC(Nc2ncnc3c2ncn3[C@@H]2O[C@H](CO)C[C@H]2O)C1 |
| InChI | InChI=1S/C21H23FN6O4/c22-15-3-1-2-12(8-29)18(15)27-5-4-13(7-27)26-19-17-20(24-10-23-19)28(11-25-17)21-16(31)6-14(9-30)32-21/h1-3,8,10-11,13-14,16,21,30-31H,4-7,9H2,(H,23,24,26)/t13?,14-,16+,21+/m0/s1 |
| InChIKey | PUERBENYMCBDDL-MZJUXLLISA-N |
| XLogP | 1.11 |
| TPSA | 125.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.45 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|