C20H25N7O4S — CID 18725646
(2R,3R,4S,5R)-2-(hydroxymethyl)-5-[6-[[(3S)-1-(5-methylsulfanyl-2-pyridinyl)pyrrolidin-3-yl]amino]purin-9-yl]oxolane-3,4-diol (PubChem CID 18725646) has the molecular formula C20H25N7O4S and a molecular weight of 459.53 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-(hydroxymethyl)-5-[6-[[(3S)-1-(5-methylsulfanyl-2-pyridinyl)pyrrolidin-3-yl]amino]purin-9-yl]oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-(hydroxymethyl)-5-[6-[[(3S)-1-(5-methylsulfanyl-2-pyridinyl)pyrrolidin-3-yl]amino]purin-9-yl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 18725646 |
| Molecular Formula | C20H25N7O4S |
| Molecular Weight | 459.53 g/mol |
| Exact Mass | 459.17 |
| IUPAC Name | (2R,3R,4S,5R)-2-(hydroxymethyl)-5-[6-[[(3S)-1-(5-methylsulfanyl-2-pyridinyl)pyrrolidin-3-yl]amino]purin-9-yl]oxolane-3,4-diol |
| SMILES | CSc1ccc(N2CC[C@H](Nc3ncnc4c3ncn4[C@@H]3O[C@H](CO)[C@H](O)[C@@H]3O)C2)nc1 |
| InChI | InChI=1S/C20H25N7O4S/c1-32-12-2-3-14(21-6-12)26-5-4-11(7-26)25-18-15-19(23-9-22-18)27(10-24-15)20-17(30)16(29)13(8-28)31-20/h2-3,6,9-11,13,16-17,20,28-30H,4-5,7-8H2,1H3,(H,22,23,25)/t11-,13+,16-,17-,20+/m0/s1 |
| InChIKey | ZVGRGHPRKLQEGJ-YHMDSTKJSA-N |
| XLogP | 0.25 |
| TPSA | 141.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.53 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |