C17H26N5O6P — CID 146507074
[(2S,4R,5R)-5-[6-(cyclohexylamino)purin-9-yl]-4-hydroxyoxolan-2-yl]methoxymethylphosphonic acid (PubChem CID 146507074) has the molecular formula C17H26N5O6P and a molecular weight of 427.40 g/mol. Its IUPAC name is [(2S,4R,5R)-5-[6-(cyclohexylamino)purin-9-yl]-4-hydroxyoxolan-2-yl]methoxymethylphosphonic acid.
| Compound Name | [(2S,4R,5R)-5-[6-(cyclohexylamino)purin-9-yl]-4-hydroxyoxolan-2-yl]methoxymethylphosphonic acid |
|---|---|
| PubChem CID | 146507074 |
| Molecular Formula | C17H26N5O6P |
| Molecular Weight | 427.40 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | [(2S,4R,5R)-5-[6-(cyclohexylamino)purin-9-yl]-4-hydroxyoxolan-2-yl]methoxymethylphosphonic acid |
| SMILES | O=P(O)(O)COC[C@@H]1C[C@@H](O)[C@H](n2cnc3c(NC4CCCCC4)ncnc32)O1 |
| InChI | InChI=1S/C17H26N5O6P/c23-13-6-12(7-27-10-29(24,25)26)28-17(13)22-9-20-14-15(18-8-19-16(14)22)21-11-4-2-1-3-5-11/h8-9,11-13,17,23H,1-7,10H2,(H,18,19,21)(H2,24,25,26)/t12-,13+,17+/m0/s1 |
| InChIKey | MNGFIHDRMZRNEM-OGHNNQOOSA-N |
| XLogP | 1.37 |
| TPSA | 151.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.40 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|