C18H24F3N5O4 — CID 58332700
7-[[9-[(2R,3S,5R)-5-ethyl-3,4-dihydroxyoxolan-2-yl]purin-6-yl]amino]-1,1,1-trifluoroheptan-2-one (PubChem CID 58332700) has the molecular formula C18H24F3N5O4 and a molecular weight of 431.42 g/mol. Its IUPAC name is 7-[[9-[(2R,3S,5R)-5-ethyl-3,4-dihydroxyoxolan-2-yl]purin-6-yl]amino]-1,1,1-trifluoroheptan-2-one.
| Compound Name | 7-[[9-[(2R,3S,5R)-5-ethyl-3,4-dihydroxyoxolan-2-yl]purin-6-yl]amino]-1,1,1-trifluoroheptan-2-one |
|---|---|
| PubChem CID | 58332700 |
| Molecular Formula | C18H24F3N5O4 |
| Molecular Weight | 431.42 g/mol |
| Exact Mass | 431.18 |
| IUPAC Name | 7-[[9-[(2R,3S,5R)-5-ethyl-3,4-dihydroxyoxolan-2-yl]purin-6-yl]amino]-1,1,1-trifluoroheptan-2-one |
| SMILES | CC[C@H]1O[C@@H](n2cnc3c(NCCCCCC(=O)C(F)(F)F)ncnc32)[C@@H](O)C1O |
| InChI | InChI=1S/C18H24F3N5O4/c1-2-10-13(28)14(29)17(30-10)26-9-25-12-15(23-8-24-16(12)26)22-7-5-3-4-6-11(27)18(19,20)21/h8-10,13-14,17,28-29H,2-7H2,1H3,(H,22,23,24)/t10-,13?,14+,17-/m1/s1 |
| InChIKey | MTPIKPBTMAFFFW-WYNAFHSXSA-N |
| XLogP | 1.96 |
| TPSA | 122.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.42 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|