C12H17IN6O3 — CID 172538583
(2R,3S,5S)-2-[6-(2-aminoethylamino)purin-9-yl]-5-(iodomethyl)oxolane-3,4-diol (PubChem CID 172538583) has the molecular formula C12H17IN6O3 and a molecular weight of 420.21 g/mol. Its IUPAC name is (2R,3S,5S)-2-[6-(2-aminoethylamino)purin-9-yl]-5-(iodomethyl)oxolane-3,4-diol.
| Compound Name | (2R,3S,5S)-2-[6-(2-aminoethylamino)purin-9-yl]-5-(iodomethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 172538583 |
| Molecular Formula | C12H17IN6O3 |
| Molecular Weight | 420.21 g/mol |
| Exact Mass | 420.04 |
| IUPAC Name | (2R,3S,5S)-2-[6-(2-aminoethylamino)purin-9-yl]-5-(iodomethyl)oxolane-3,4-diol |
| SMILES | NCCNc1ncnc2c1ncn2[C@@H]1O[C@H](CI)C(O)[C@@H]1O |
| InChI | InChI=1S/C12H17IN6O3/c13-3-6-8(20)9(21)12(22-6)19-5-18-7-10(15-2-1-14)16-4-17-11(7)19/h4-6,8-9,12,20-21H,1-3,14H2,(H,15,16,17)/t6-,8?,9+,12-/m1/s1 |
| InChIKey | YZYUHMVOBXAFFU-WURNFRPNSA-N |
| XLogP | -0.75 |
| TPSA | 131.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.21 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|